C11H23N3O3S2 — CID 106338832
2-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]-2-ethylbutanamide (PubChem CID 106338832) has the molecular formula C11H23N3O3S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is 2-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]-2-ethylbutanamide.
| Compound Name | 2-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 106338832 |
| Molecular Formula | C11H23N3O3S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]-2-ethylbutanamide |
| SMILES | CCC(CC)(C(=O)NCCS(=O)(=O)N(C)C)C(N)=S |
| InChI | InChI=1S/C11H23N3O3S2/c1-5-11(6-2,9(12)18)10(15)13-7-8-19(16,17)14(3)4/h5-8H2,1-4H3,(H2,12,18)(H,13,15) |
| InChIKey | GPYLLFATICWWNV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|