C10H19N3O3S2 — CID 106338824
1-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]cyclobutane-1-carboxamide (PubChem CID 106338824) has the molecular formula C10H19N3O3S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 106338824 |
| Molecular Formula | C10H19N3O3S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]cyclobutane-1-carboxamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)C1(C(N)=S)CCC1 |
| InChI | InChI=1S/C10H19N3O3S2/c1-13(2)18(15,16)7-6-12-9(14)10(8(11)17)4-3-5-10/h3-7H2,1-2H3,(H2,11,17)(H,12,14) |
| InChIKey | PKYNYFYOPCQGBD-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|