C11H21N3O4S2 — CID 106338837
4-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]oxane-4-carboxamide (PubChem CID 106338837) has the molecular formula C11H21N3O4S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]oxane-4-carboxamide.
| Compound Name | 4-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 106338837 |
| Molecular Formula | C11H21N3O4S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 4-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]oxane-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)C1(C(N)=S)CCOCC1 |
| InChI | InChI=1S/C11H21N3O4S2/c1-14(2)20(16,17)8-5-13-10(15)11(9(12)19)3-6-18-7-4-11/h3-8H2,1-2H3,(H2,12,19)(H,13,15) |
| InChIKey | SWPIUGRMIIGIFF-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|