C10H15F3N2O2S2 — CID 106428815
4-carbamothioyl-N-[2-(trifluoromethylsulfanyl)ethyl]oxane-4-carboxamide (PubChem CID 106428815) has the molecular formula C10H15F3N2O2S2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 4-carbamothioyl-N-[2-(trifluoromethylsulfanyl)ethyl]oxane-4-carboxamide.
| Compound Name | 4-carbamothioyl-N-[2-(trifluoromethylsulfanyl)ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 106428815 |
| Molecular Formula | C10H15F3N2O2S2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-carbamothioyl-N-[2-(trifluoromethylsulfanyl)ethyl]oxane-4-carboxamide |
| SMILES | NC(=S)C1(C(=O)NCCSC(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C10H15F3N2O2S2/c11-10(12,13)19-6-3-15-8(16)9(7(14)18)1-4-17-5-2-9/h1-6H2,(H2,14,18)(H,15,16) |
| InChIKey | IFIMQFREIILDGN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|