C9H13F3N2O2S — CID 80591543
1-carbamothioyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclopropane-1-carboxamide (PubChem CID 80591543) has the molecular formula C9H13F3N2O2S and a molecular weight of 270.28 g/mol. Its IUPAC name is 1-carbamothioyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80591543 |
| Molecular Formula | C9H13F3N2O2S |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 1-carbamothioyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclopropane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)NCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H13F3N2O2S/c10-9(11,12)5-16-4-3-14-7(15)8(1-2-8)6(13)17/h1-5H2,(H2,13,17)(H,14,15) |
| InChIKey | DRIRZLXQMFQWKU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|