C12H19F3N2O2S — CID 63828489
1-carbamothioyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide (PubChem CID 63828489) has the molecular formula C12H19F3N2O2S and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-carbamothioyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 63828489 |
| Molecular Formula | C12H19F3N2O2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-carbamothioyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)NCCOCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C12H19F3N2O2S/c13-12(14,15)8-19-7-6-17-10(18)11(9(16)20)4-2-1-3-5-11/h1-8H2,(H2,16,20)(H,17,18) |
| InChIKey | INAJEQDJYVMASX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|