C11H20ClF3N2O2 — CID 119279337
1-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119279337) has the molecular formula C11H20ClF3N2O2 and a molecular weight of 304.74 g/mol. Its IUPAC name is 1-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119279337 |
| Molecular Formula | C11H20ClF3N2O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1(C(=O)NCCOCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C11H19F3N2O2.ClH/c12-11(13,14)8-18-7-6-16-9(17)10(15)4-2-1-3-5-10;/h1-8,15H2,(H,16,17);1H |
| InChIKey | PEKCWBGOWMUBDI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|