C11H20ClF3N2O — CID 119322435
1-amino-N-(4,4,4-trifluorobutyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119322435) has the molecular formula C11H20ClF3N2O and a molecular weight of 288.74 g/mol. Its IUPAC name is 1-amino-N-(4,4,4-trifluorobutyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-(4,4,4-trifluorobutyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119322435 |
| Molecular Formula | C11H20ClF3N2O |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 1-amino-N-(4,4,4-trifluorobutyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1(C(=O)NCCCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C11H19F3N2O.ClH/c12-11(13,14)7-4-8-16-9(17)10(15)5-2-1-3-6-10;/h1-8,15H2,(H,16,17);1H |
| InChIKey | QXOXCVOWJJSAKT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|