C16H22ClF3N2O2 — CID 119296688
1-amino-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119296688) has the molecular formula C16H22ClF3N2O2 and a molecular weight of 366.81 g/mol. Its IUPAC name is 1-amino-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 1-amino-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119296688 |
| Molecular Formula | C16H22ClF3N2O2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-amino-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1(C(=O)NCCOc2ccc(C(F)(F)F)cc2)CCCCC1 |
| InChI | InChI=1S/C16H21F3N2O2.ClH/c17-16(18,19)12-4-6-13(7-5-12)23-11-10-21-14(22)15(20)8-2-1-3-9-15;/h4-7H,1-3,8-11,20H2,(H,21,22);1H |
| InChIKey | QILLSJUXPSPDOT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|