C14H16F3N3O3 — CID 99780583
1-(carbamoylamino)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]cyclopropane-1-carboxamide (PubChem CID 99780583) has the molecular formula C14H16F3N3O3 and a molecular weight of 331.29 g/mol. Its IUPAC name is 1-(carbamoylamino)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(carbamoylamino)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 99780583 |
| Molecular Formula | C14H16F3N3O3 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-(carbamoylamino)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]cyclopropane-1-carboxamide |
| SMILES | NC(=O)NC1(C(=O)NCCOc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C14H16F3N3O3/c15-14(16,17)9-1-3-10(4-2-9)23-8-7-19-11(21)13(5-6-13)20-12(18)22/h1-4H,5-8H2,(H,19,21)(H3,18,20,22) |
| InChIKey | KONDJMPJOOCMEK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|