C17H15ClF3NO2 — CID 55803102
2-(4-chlorophenyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide (PubChem CID 55803102) has the molecular formula C17H15ClF3NO2 and a molecular weight of 357.76 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 55803102 |
| Molecular Formula | C17H15ClF3NO2 |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCCOc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15ClF3NO2/c18-14-5-1-12(2-6-14)11-16(23)22-9-10-24-15-7-3-13(4-8-15)17(19,20)21/h1-8H,9-11H2,(H,22,23) |
| InChIKey | PZNHIFGIGVPWPP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|