C20H22ClNO2 — CID 113101563
2-(4-chlorophenyl)-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]acetamide (PubChem CID 113101563) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]acetamide |
|---|---|
| PubChem CID | 113101563 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCCOc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C20H22ClNO2/c21-18-8-5-15(6-9-18)13-20(23)22-11-12-24-19-10-7-16-3-1-2-4-17(16)14-19/h5-10,14H,1-4,11-13H2,(H,22,23) |
| InChIKey | IZKFIZFJIVEWMY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|