C16H23NO2 — CID 113101532
N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]butanamide (PubChem CID 113101532) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]butanamide.
| Compound Name | N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]butanamide |
|---|---|
| PubChem CID | 113101532 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)ethyl]butanamide |
| SMILES | CCCC(=O)NCCOc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H23NO2/c1-2-5-16(18)17-10-11-19-15-9-8-13-6-3-4-7-14(13)12-15/h8-9,12H,2-7,10-11H2,1H3,(H,17,18) |
| InChIKey | RCCSYQWMJFRYGX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|