C19H20F3NO4 — CID 78892262
2-(2,5-dimethoxyphenyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide (PubChem CID 78892262) has the molecular formula C19H20F3NO4 and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide.
| Compound Name | 2-(2,5-dimethoxyphenyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 78892262 |
| Molecular Formula | C19H20F3NO4 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]acetamide |
| SMILES | COc1ccc(OC)c(CC(=O)NCCOc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H20F3NO4/c1-25-16-7-8-17(26-2)13(11-16)12-18(24)23-9-10-27-15-5-3-14(4-6-15)19(20,21)22/h3-8,11H,9-10,12H2,1-2H3,(H,23,24) |
| InChIKey | NZMFGFCSZFEDRM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|