C16H14ClF3N2O2S — CID 35149223
N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide (PubChem CID 35149223) has the molecular formula C16H14ClF3N2O2S and a molecular weight of 390.81 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 35149223 |
| Molecular Formula | C16H14ClF3N2O2S |
| Molecular Weight | 390.81 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]acetamide |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cn1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClF3N2O2S/c17-12-2-4-13(5-3-12)24-8-7-21-14(23)10-25-15-6-1-11(9-22-15)16(18,19)20/h1-6,9H,7-8,10H2,(H,21,23) |
| InChIKey | WZOKJBZCMJQASE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.81 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|