C20H22ClN3O3S — CID 32941899
N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(pyrrolidine-1-carbonyl)-2-pyridinyl]sulfanyl]acetamide (PubChem CID 32941899) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(pyrrolidine-1-carbonyl)-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(pyrrolidine-1-carbonyl)-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 32941899 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-[[5-(pyrrolidine-1-carbonyl)-2-pyridinyl]sulfanyl]acetamide |
| SMILES | O=C(CSc1ccc(C(=O)N2CCCC2)cn1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClN3O3S/c21-16-4-6-17(7-5-16)27-12-9-22-18(25)14-28-19-8-3-15(13-23-19)20(26)24-10-1-2-11-24/h3-8,13H,1-2,9-12,14H2,(H,22,25) |
| InChIKey | RYYNRPHQTSYDED-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|