C12H12ClN3O2S2 — CID 40749903
N-[2-(4-chlorophenoxy)ethyl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide (PubChem CID 40749903) has the molecular formula C12H12ClN3O2S2 and a molecular weight of 329.83 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 40749903 |
| Molecular Formula | C12H12ClN3O2S2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nncs1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClN3O2S2/c13-9-1-3-10(4-2-9)18-6-5-14-11(17)7-19-12-16-15-8-20-12/h1-4,8H,5-7H2,(H,14,17) |
| InChIKey | YOWZABUMHSWKMV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|