C10H17N3OS2 — CID 47115885
N-hexyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide (PubChem CID 47115885) has the molecular formula C10H17N3OS2 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-hexyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-hexyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 47115885 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-hexyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
| SMILES | CCCCCCNC(=O)CSc1nncs1 |
| InChI | InChI=1S/C10H17N3OS2/c1-2-3-4-5-6-11-9(14)7-15-10-13-12-8-16-10/h8H,2-7H2,1H3,(H,11,14) |
| InChIKey | YGPKPJNSPIJGRP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|