C12H12F3N5OS2 — CID 51122393
2-(1,3,4-thiadiazol-2-ylsulfanyl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 51122393) has the molecular formula C12H12F3N5OS2 and a molecular weight of 363.39 g/mol. Its IUPAC name is 2-(1,3,4-thiadiazol-2-ylsulfanyl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | 2-(1,3,4-thiadiazol-2-ylsulfanyl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 51122393 |
| Molecular Formula | C12H12F3N5OS2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-(1,3,4-thiadiazol-2-ylsulfanyl)-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | O=C(CSc1nncs1)NCCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3N5OS2/c13-12(14,15)8-2-1-3-17-10(8)18-5-4-16-9(21)6-22-11-20-19-7-23-11/h1-3,7H,4-6H2,(H,16,21)(H,17,18) |
| InChIKey | AHGIRXCPVRXRKT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|