C11H10F3N5OS — CID 87040895
N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,2,5-thiadiazole-3-carboxamide (PubChem CID 87040895) has the molecular formula C11H10F3N5OS and a molecular weight of 317.30 g/mol. Its IUPAC name is N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,2,5-thiadiazole-3-carboxamide.
| Compound Name | N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,2,5-thiadiazole-3-carboxamide |
|---|---|
| PubChem CID | 87040895 |
| Molecular Formula | C11H10F3N5OS |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,2,5-thiadiazole-3-carboxamide |
| SMILES | O=C(NCCNc1ncccc1C(F)(F)F)c1cnsn1 |
| InChI | InChI=1S/C11H10F3N5OS/c12-11(13,14)7-2-1-3-15-9(7)16-4-5-17-10(20)8-6-18-21-19-8/h1-3,6H,4-5H2,(H,15,16)(H,17,20) |
| InChIKey | OEHFIBAOKVIZTD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|