C15H14F3N5O2 — CID 86859159
5-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyridine-2,5-dicarboxamide (PubChem CID 86859159) has the molecular formula C15H14F3N5O2 and a molecular weight of 353.30 g/mol. Its IUPAC name is 5-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 86859159 |
| Molecular Formula | C15H14F3N5O2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 5-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]pyridine-2,5-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NCCNc2ncccc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H14F3N5O2/c16-15(17,18)10-2-1-5-20-13(10)21-6-7-22-14(25)9-3-4-11(12(19)24)23-8-9/h1-5,8H,6-7H2,(H2,19,24)(H,20,21)(H,22,25) |
| InChIKey | OCPHJUJNFJNDTF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|