C22H21F3N4O4S — CID 55834263
4-[(4-methoxyphenyl)sulfamoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide (PubChem CID 55834263) has the molecular formula C22H21F3N4O4S and a molecular weight of 494.50 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)sulfamoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide.
| Compound Name | 4-[(4-methoxyphenyl)sulfamoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55834263 |
| Molecular Formula | C22H21F3N4O4S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 4-[(4-methoxyphenyl)sulfamoyl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C(=O)NCCNc3ncccc3C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H21F3N4O4S/c1-33-17-8-6-16(7-9-17)29-34(31,32)18-10-4-15(5-11-18)21(30)28-14-13-27-20-19(22(23,24)25)3-2-12-26-20/h2-12,29H,13-14H2,1H3,(H,26,27)(H,28,30) |
| InChIKey | CVCIPHKRNIGYCQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|