C16H18F3N3O3S — CID 87032884
4-methoxy-2-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzenesulfonamide (PubChem CID 87032884) has the molecular formula C16H18F3N3O3S and a molecular weight of 389.40 g/mol. Its IUPAC name is 4-methoxy-2-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-2-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87032884 |
| Molecular Formula | C16H18F3N3O3S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 4-methoxy-2-methyl-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNc2ncccc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C16H18F3N3O3S/c1-11-10-12(25-2)5-6-14(11)26(23,24)22-9-8-21-15-13(16(17,18)19)4-3-7-20-15/h3-7,10,22H,8-9H2,1-2H3,(H,20,21) |
| InChIKey | NWVBODNNVNBPSG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|