C15H13F3N4O2S — CID 55728944
N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 55728944) has the molecular formula C15H13F3N4O2S and a molecular weight of 370.36 g/mol. Its IUPAC name is N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55728944 |
| Molecular Formula | C15H13F3N4O2S |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | N#Cc1cccnc1NCCNS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H13F3N4O2S/c16-15(17,18)12-5-1-2-6-13(12)25(23,24)22-9-8-21-14-11(10-19)4-3-7-20-14/h1-7,22H,8-9H2,(H,20,21) |
| InChIKey | DVKMYMSMRLTEOW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|