C16H14F3N3S — CID 112820590
2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethylsulfanylmethyl]benzonitrile (PubChem CID 112820590) has the molecular formula C16H14F3N3S and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethylsulfanylmethyl]benzonitrile.
| Compound Name | 2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethylsulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 112820590 |
| Molecular Formula | C16H14F3N3S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethylsulfanylmethyl]benzonitrile |
| SMILES | N#Cc1ccccc1CSCCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C16H14F3N3S/c17-16(18,19)14-6-3-7-21-15(14)22-8-9-23-11-13-5-2-1-4-12(13)10-20/h1-7H,8-9,11H2,(H,21,22) |
| InChIKey | GWXKAGUWDUUGAP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|