About 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine
3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine (PubChem CID 63226841) has the molecular formula C9H8F6N2
and a molecular weight of 258.16 g/mol. Its IUPAC name is 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine |
| PubChem CID | 63226841 |
| Molecular Formula | C9H8F6N2 |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine |
| SMILES | FC(F)(F)CCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C9H8F6N2/c10-8(11,12)3-5-17-7-6(9(13,14)15)2-1-4-16-7/h1-2,4H,3,5H2,(H,16,17) |
| InChIKey | PAGNUQUFUNKZMB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine?
The IUPAC name of 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine (CID 63226841) is 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine.
What is the SMILES notation for 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine?
The canonical SMILES for 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine is FC(F)(F)CCNc1ncccc1C(F)(F)F.
What is the InChIKey of 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine?
The InChIKey is PAGNUQUFUNKZMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F6N2/c10-8(11,12)3-5-17-7-6(9(13,14)15)2-1-4-16-7/h1-2,4H,3,5H2,(H,16,17).
What are the key properties of 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine?
3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine has a molecular weight of 258.16 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)-N-(3,3,3-trifluoropropyl)pyridin-2-amine is sourced from PubChem (CID 63226841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).