C12H16F3N3 — CID 43599663
N-cyclopropyl-N'-[3-(trifluoromethyl)-2-pyridinyl]propane-1,3-diamine (PubChem CID 43599663) has the molecular formula C12H16F3N3 and a molecular weight of 259.27 g/mol. Its IUPAC name is N-cyclopropyl-N'-[3-(trifluoromethyl)-2-pyridinyl]propane-1,3-diamine.
| Compound Name | N-cyclopropyl-N'-[3-(trifluoromethyl)-2-pyridinyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 43599663 |
| Molecular Formula | C12H16F3N3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-cyclopropyl-N'-[3-(trifluoromethyl)-2-pyridinyl]propane-1,3-diamine |
| SMILES | FC(F)(F)c1cccnc1NCCCNC1CC1 |
| InChI | InChI=1S/C12H16F3N3/c13-12(14,15)10-3-1-6-17-11(10)18-8-2-7-16-9-4-5-9/h1,3,6,9,16H,2,4-5,7-8H2,(H,17,18) |
| InChIKey | NGPOHIDGTFXGKL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|