C13H16F3NO2S — CID 106584745
N-[3-[2-(trifluoromethyl)phenyl]sulfonylpropyl]cyclopropanamine (PubChem CID 106584745) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is N-[3-[2-(trifluoromethyl)phenyl]sulfonylpropyl]cyclopropanamine.
| Compound Name | N-[3-[2-(trifluoromethyl)phenyl]sulfonylpropyl]cyclopropanamine |
|---|---|
| PubChem CID | 106584745 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-[3-[2-(trifluoromethyl)phenyl]sulfonylpropyl]cyclopropanamine |
| SMILES | O=S(=O)(CCCNC1CC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO2S/c14-13(15,16)11-4-1-2-5-12(11)20(18,19)9-3-8-17-10-6-7-10/h1-2,4-5,10,17H,3,6-9H2 |
| InChIKey | XBTKVMCDLVYDNV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|