C11H12F3NO2S — CID 115071057
2-[[2-(trifluoromethyl)phenyl]sulfonylmethyl]azetidine (PubChem CID 115071057) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)phenyl]sulfonylmethyl]azetidine.
| Compound Name | 2-[[2-(trifluoromethyl)phenyl]sulfonylmethyl]azetidine |
|---|---|
| PubChem CID | 115071057 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-[[2-(trifluoromethyl)phenyl]sulfonylmethyl]azetidine |
| SMILES | O=S(=O)(CC1CCN1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO2S/c12-11(13,14)9-3-1-2-4-10(9)18(16,17)7-8-5-6-15-8/h1-4,8,15H,5-7H2 |
| InChIKey | XNXYWKWARSFSTG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |