C12H13F3O3S — CID 106585400
2-[2-(trifluoromethyl)phenyl]sulfonylcyclopentan-1-ol (PubChem CID 106585400) has the molecular formula C12H13F3O3S and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)phenyl]sulfonylcyclopentan-1-ol.
| Compound Name | 2-[2-(trifluoromethyl)phenyl]sulfonylcyclopentan-1-ol |
|---|---|
| PubChem CID | 106585400 |
| Molecular Formula | C12H13F3O3S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[2-(trifluoromethyl)phenyl]sulfonylcyclopentan-1-ol |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)C1CCCC1O |
| InChI | InChI=1S/C12H13F3O3S/c13-12(14,15)8-4-1-2-6-10(8)19(17,18)11-7-3-5-9(11)16/h1-2,4,6,9,11,16H,3,5,7H2 |
| InChIKey | ICLWZGNREWWZSM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |