C12H16O3S — CID 11746739
cis-(1S,2R)-2-(benzenesulfonyl)cyclohexan-1-ol (PubChem CID 11746739) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is cis-(1S,2R)-2-(benzenesulfonyl)cyclohexan-1-ol.
| Compound Name | cis-(1S,2R)-2-(benzenesulfonyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11746739 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | cis-(1S,2R)-2-(benzenesulfonyl)cyclohexan-1-ol |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H16O3S/c13-11-8-4-5-9-12(11)16(14,15)10-6-2-1-3-7-10/h1-3,6-7,11-13H,4-5,8-9H2/t11-,12+/m0/s1 |
| InChIKey | BYEVDKBZRBSHTR-NWDGAFQWSA-N |
| XLogP | 1.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |