C13H18O3S — CID 164781537
(1R,2R,5R)-2-(benzenesulfonyl)-5-methylcyclohexan-1-ol (PubChem CID 164781537) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is (1R,2R,5R)-2-(benzenesulfonyl)-5-methylcyclohexan-1-ol.
| Compound Name | (1R,2R,5R)-2-(benzenesulfonyl)-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 164781537 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (1R,2R,5R)-2-(benzenesulfonyl)-5-methylcyclohexan-1-ol |
| SMILES | C[C@@H]1CC[C@@H](S(=O)(=O)c2ccccc2)[C@H](O)C1 |
| InChI | InChI=1S/C13H18O3S/c1-10-7-8-13(12(14)9-10)17(15,16)11-5-3-2-4-6-11/h2-6,10,12-14H,7-9H2,1H3/t10-,12-,13-/m1/s1 |
| InChIKey | JMEMCSBCNVAWFN-RAIGVLPGSA-N |
| XLogP | 2.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |