C13H18O2S — CID 102011157
[(1R,2R)-2-methylcyclohexyl]sulfonylbenzene (PubChem CID 102011157) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is [(1R,2R)-2-methylcyclohexyl]sulfonylbenzene.
| Compound Name | [(1R,2R)-2-methylcyclohexyl]sulfonylbenzene |
|---|---|
| PubChem CID | 102011157 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [(1R,2R)-2-methylcyclohexyl]sulfonylbenzene |
| SMILES | C[C@@H]1CCCC[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-11-7-5-6-10-13(11)16(14,15)12-8-3-2-4-9-12/h2-4,8-9,11,13H,5-7,10H2,1H3/t11-,13-/m1/s1 |
| InChIKey | LQVCCNWSEWCHEN-DGCLKSJQSA-N |
| XLogP | 3.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |