C13H19NO3S — CID 15528492
N-[(1S,2S)-2-(benzenesulfonyl)cyclohexyl]-N-methylhydroxylamine (PubChem CID 15528492) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-[(1S,2S)-2-(benzenesulfonyl)cyclohexyl]-N-methylhydroxylamine.
| Compound Name | N-[(1S,2S)-2-(benzenesulfonyl)cyclohexyl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 15528492 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[(1S,2S)-2-(benzenesulfonyl)cyclohexyl]-N-methylhydroxylamine |
| SMILES | CN(O)[C@H]1CCCC[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO3S/c1-14(15)12-9-5-6-10-13(12)18(16,17)11-7-3-2-4-8-11/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | YVXPWSVSGWKMAT-STQMWFEESA-N |
| XLogP | 2.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|