C9H11NO2S — CID 99999285
cis-(1S,2R)-2-(benzenesulfonyl)cyclopropan-1-amine (PubChem CID 99999285) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is cis-(1S,2R)-2-(benzenesulfonyl)cyclopropan-1-amine.
| Compound Name | cis-(1S,2R)-2-(benzenesulfonyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 99999285 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | cis-(1S,2R)-2-(benzenesulfonyl)cyclopropan-1-amine |
| SMILES | N[C@H]1C[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO2S/c10-8-6-9(8)13(11,12)7-4-2-1-3-5-7/h1-5,8-9H,6,10H2/t8-,9+/m0/s1 |
| InChIKey | BCWOIEUIRGXSFG-DTWKUNHWSA-N |
| XLogP | 0.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |