C11H15NO3S — CID 10911682
(1R,2R,3R)-2-amino-3-(benzenesulfonyl)cyclopentan-1-ol (PubChem CID 10911682) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is (1R,2R,3R)-2-amino-3-(benzenesulfonyl)cyclopentan-1-ol.
| Compound Name | (1R,2R,3R)-2-amino-3-(benzenesulfonyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 10911682 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | (1R,2R,3R)-2-amino-3-(benzenesulfonyl)cyclopentan-1-ol |
| SMILES | N[C@@H]1[C@H](O)CC[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO3S/c12-11-9(13)6-7-10(11)16(14,15)8-4-2-1-3-5-8/h1-5,9-11,13H,6-7,12H2/t9-,10-,11-/m1/s1 |
| InChIKey | JXYYXAYHKDJRPL-GMTAPVOTSA-N |
| XLogP | 0.31 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |