C16H24O3S — CID 15444149
(1R,2S,4R)-2-(benzenesulfonyl)-4-tert-butylcyclohexan-1-ol (PubChem CID 15444149) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is (1R,2S,4R)-2-(benzenesulfonyl)-4-tert-butylcyclohexan-1-ol.
| Compound Name | (1R,2S,4R)-2-(benzenesulfonyl)-4-tert-butylcyclohexan-1-ol |
|---|---|
| PubChem CID | 15444149 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (1R,2S,4R)-2-(benzenesulfonyl)-4-tert-butylcyclohexan-1-ol |
| SMILES | CC(C)(C)[C@@H]1CC[C@@H](O)[C@@H](S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H24O3S/c1-16(2,3)12-9-10-14(17)15(11-12)20(18,19)13-7-5-4-6-8-13/h4-8,12,14-15,17H,9-11H2,1-3H3/t12-,14-,15+/m1/s1 |
| InChIKey | NAXNHUNMMFREPJ-YUELXQCFSA-N |
| XLogP | 3.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |