C16H24O2 — CID 134851206
(1S,2S,4S)-4-tert-butyl-2-phenoxycyclohexan-1-ol (PubChem CID 134851206) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1S,2S,4S)-4-tert-butyl-2-phenoxycyclohexan-1-ol.
| Compound Name | (1S,2S,4S)-4-tert-butyl-2-phenoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 134851206 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1S,2S,4S)-4-tert-butyl-2-phenoxycyclohexan-1-ol |
| SMILES | CC(C)(C)[C@H]1CC[C@H](O)[C@@H](Oc2ccccc2)C1 |
| InChI | InChI=1S/C16H24O2/c1-16(2,3)12-9-10-14(17)15(11-12)18-13-7-5-4-6-8-13/h4-8,12,14-15,17H,9-11H2,1-3H3/t12-,14-,15-/m0/s1 |
| InChIKey | UQQOPEBMXGTHST-QEJZJMRPSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |