C18H28O2 — CID 63472729
4-tert-butyl-2-(3,4-dimethylphenoxy)cyclohexan-1-ol (PubChem CID 63472729) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 4-tert-butyl-2-(3,4-dimethylphenoxy)cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-2-(3,4-dimethylphenoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 63472729 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 4-tert-butyl-2-(3,4-dimethylphenoxy)cyclohexan-1-ol |
| SMILES | Cc1ccc(OC2CC(C(C)(C)C)CCC2O)cc1C |
| InChI | InChI=1S/C18H28O2/c1-12-6-8-15(10-13(12)2)20-17-11-14(18(3,4)5)7-9-16(17)19/h6,8,10,14,16-17,19H,7,9,11H2,1-5H3 |
| InChIKey | DPENFUYIJHSIKK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |