C16H24O2 — CID 16033
2-(4-(1,1-Dimethylethyl)phenoxy)cyclohexanol (PubChem CID 16033) has the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)cyclohexan-1-ol.
| Compound Name | 2-(4-(1,1-Dimethylethyl)phenoxy)cyclohexanol |
|---|---|
| PubChem CID | 16033 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 2-(4-tert-butylphenoxy)cyclohexan-1-ol |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OC2CCCCC2O |
| InChI | InChI=1S/C16H24O2/c1-16(2,3)12-8-10-13(11-9-12)18-15-7-5-4-6-14(15)17/h8-11,14-15,17H,4-7H2,1-3H3 |
| InChIKey | FTIXUILRMBSXNS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | 248 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |