About Nonaethylene Glycol Nonylphenyl Ether
Nonaethylene Glycol Nonylphenyl Ether (PubChem CID 72385) has the molecular formula C33H60O10
and a molecular weight of 616.80 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
Molecular Properties
| Compound Name | Nonaethylene Glycol Nonylphenyl Ether |
| PubChem CID | 72385 |
| Molecular Formula | C33H60O10 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.42 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CCCCCCCCCC1=CC=C(C=C1)OCCOCCOCCOCCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C33H60O10/c1-2-3-4-5-6-7-8-9-32-10-12-33(13-11-32)43-31-30-42-29-28-41-27-26-40-25-24-39-23-22-38-21-20-37-19-18-36-17-16-35-15-14-34/h10-13,34H,2-9,14-31H2,1H3 |
| InChIKey | FBWNMEQMRUMQSO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 43 |
| Complexity | 520 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Nonaethylene Glycol Nonylphenyl Ether with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Nonaethylene Glycol Nonylphenyl Ether?
The IUPAC name of Nonaethylene Glycol Nonylphenyl Ether (CID 72385) is 2-[2-[2-[2-[2-[2-[2-[2-[2-(4-nonylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
What is the SMILES notation for Nonaethylene Glycol Nonylphenyl Ether?
The canonical SMILES for Nonaethylene Glycol Nonylphenyl Ether is CCCCCCCCCC1=CC=C(C=C1)OCCOCCOCCOCCOCCOCCOCCOCCOCCO.
What is the InChIKey of Nonaethylene Glycol Nonylphenyl Ether?
The InChIKey is FBWNMEQMRUMQSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H60O10/c1-2-3-4-5-6-7-8-9-32-10-12-33(13-11-32)43-31-30-42-29-28-41-27-26-40-25-24-39-23-22-38-21-20-37-19-18-36-17-16-35-15-14-34/h10-13,34H,2-9,14-31H2,1H3.
What are the key properties of Nonaethylene Glycol Nonylphenyl Ether?
Nonaethylene Glycol Nonylphenyl Ether has a molecular weight of 616.80 g/mol, XLogP of 4.60, 35 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for Nonaethylene Glycol Nonylphenyl Ether is sourced from PubChem (CID 72385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).