About 4-Methoxyphenethyl alcohol
4-Methoxyphenethyl alcohol (PubChem CID 69705) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethanol.
Molecular Properties
| Compound Name | 4-Methoxyphenethyl alcohol |
| PubChem CID | 69705 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-(4-methoxyphenyl)ethanol |
| SMILES | COC1=CC=C(C=C1)CCO |
| InChI | InChI=1S/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,10H,6-7H2,1H3 |
| InChIKey | AUWDOZOUJWEPBA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 29.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | 95 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-Methoxyphenethyl alcohol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Methoxyphenethyl alcohol?
The IUPAC name of 4-Methoxyphenethyl alcohol (CID 69705) is 2-(4-methoxyphenyl)ethanol.
What is the SMILES notation for 4-Methoxyphenethyl alcohol?
The canonical SMILES for 4-Methoxyphenethyl alcohol is COC1=CC=C(C=C1)CCO.
What is the InChIKey of 4-Methoxyphenethyl alcohol?
The InChIKey is AUWDOZOUJWEPBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5,10H,6-7H2,1H3.
What are the key properties of 4-Methoxyphenethyl alcohol?
4-Methoxyphenethyl alcohol has a molecular weight of 152.19 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Methoxyphenethyl alcohol is sourced from PubChem (CID 69705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).