About [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite
[2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite (PubChem CID 4936) has the molecular formula C19H26O4S
and a molecular weight of 350.48 g/mol. Its IUPAC name is [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite.
Molecular Properties
| Compound Name | [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite |
| PubChem CID | 4936 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite |
| SMILES | C#CCOS(=O)OC1CCCCC1Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H26O4S/c1-5-14-21-24(20)23-18-9-7-6-8-17(18)22-16-12-10-15(11-13-16)19(2,3)4/h1,10-13,17-18H,6-9,14H2,2-4H3 |
| InChIKey | ZYHMJXZULPZUED-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite?
The IUPAC name of [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite (CID 4936) is [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite.
What is the SMILES notation for [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite?
The canonical SMILES for [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite is C#CCOS(=O)OC1CCCCC1Oc1ccc(C(C)(C)C)cc1.
What is the InChIKey of [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite?
The InChIKey is ZYHMJXZULPZUED-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O4S/c1-5-14-21-24(20)23-18-9-7-6-8-17(18)22-16-12-10-15(11-13-16)19(2,3)4/h1,10-13,17-18H,6-9,14H2,2-4H3.
What are the key properties of [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite?
[2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite has a molecular weight of 350.48 g/mol, XLogP of 3.92, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-tert-butylphenoxy)cyclohexyl] prop-2-ynyl sulfite is sourced from PubChem (CID 4936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).