About 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite
1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite (PubChem CID 8809) has the molecular formula C15H23ClO4S
and a molecular weight of 334.87 g/mol. Its IUPAC name is 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite.
Molecular Properties
| Compound Name | 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite |
| PubChem CID | 8809 |
| Molecular Formula | C15H23ClO4S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite |
| SMILES | CC(COc1ccc(C(C)(C)C)cc1)OS(=O)OCCCl |
| InChI | InChI=1S/C15H23ClO4S/c1-12(20-21(17)19-10-9-16)11-18-14-7-5-13(6-8-14)15(2,3)4/h5-8,12H,9-11H2,1-4H3 |
| InChIKey | YKFRAOGHWKADFJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite?
The IUPAC name of 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite (CID 8809) is 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite.
What is the SMILES notation for 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite?
The canonical SMILES for 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite is CC(COc1ccc(C(C)(C)C)cc1)OS(=O)OCCCl.
What is the InChIKey of 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite?
The InChIKey is YKFRAOGHWKADFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClO4S/c1-12(20-21(17)19-10-9-16)11-18-14-7-5-13(6-8-14)15(2,3)4/h5-8,12H,9-11H2,1-4H3.
What are the key properties of 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite?
1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite has a molecular weight of 334.87 g/mol, XLogP of 3.60, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butylphenoxy)propan-2-yl 2-chloroethyl sulfite is sourced from PubChem (CID 8809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).