About 2-phenoxycyclooctan-1-ol
2-phenoxycyclooctan-1-ol (PubChem CID 22247671) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-phenoxycyclooctan-1-ol.
Molecular Properties
| Compound Name | 2-phenoxycyclooctan-1-ol |
| PubChem CID | 22247671 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2-phenoxycyclooctan-1-ol |
| SMILES | OC1CCCCCCC1Oc1ccccc1 |
| InChI | InChI=1S/C14H20O2/c15-13-10-6-1-2-7-11-14(13)16-12-8-4-3-5-9-12/h3-5,8-9,13-15H,1-2,6-7,10-11H2 |
| InChIKey | NLVRGXJBOPJYSU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenoxycyclooctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxycyclooctan-1-ol?
The IUPAC name of 2-phenoxycyclooctan-1-ol (CID 22247671) is 2-phenoxycyclooctan-1-ol.
What is the SMILES notation for 2-phenoxycyclooctan-1-ol?
The canonical SMILES for 2-phenoxycyclooctan-1-ol is OC1CCCCCCC1Oc1ccccc1.
What is the InChIKey of 2-phenoxycyclooctan-1-ol?
The InChIKey is NLVRGXJBOPJYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c15-13-10-6-1-2-7-11-14(13)16-12-8-4-3-5-9-12/h3-5,8-9,13-15H,1-2,6-7,10-11H2.
What are the key properties of 2-phenoxycyclooctan-1-ol?
2-phenoxycyclooctan-1-ol has a molecular weight of 220.31 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxycyclooctan-1-ol is sourced from PubChem (CID 22247671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).