C17H18O3 — CID 102735416
trans-(1S,2S)-2-(4-phenoxyphenoxy)cyclopentan-1-ol (PubChem CID 102735416) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-phenoxyphenoxy)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(4-phenoxyphenoxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102735416 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | trans-(1S,2S)-2-(4-phenoxyphenoxy)cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1Oc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C17H18O3/c18-16-7-4-8-17(16)20-15-11-9-14(10-12-15)19-13-5-2-1-3-6-13/h1-3,5-6,9-12,16-18H,4,7-8H2/t16-,17-/m0/s1 |
| InChIKey | AIFMFSLYNKYJNZ-IRXDYDNUSA-N |
| XLogP | 3.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |