C12H14O3 — CID 87176687
4-[(1R,2R)-2-hydroxycyclopentyl]oxybenzaldehyde (PubChem CID 87176687) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-[(1R,2R)-2-hydroxycyclopentyl]oxybenzaldehyde.
| Compound Name | 4-[(1R,2R)-2-hydroxycyclopentyl]oxybenzaldehyde |
|---|---|
| PubChem CID | 87176687 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-[(1R,2R)-2-hydroxycyclopentyl]oxybenzaldehyde |
| SMILES | O=Cc1ccc(O[C@@H]2CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C12H14O3/c13-8-9-4-6-10(7-5-9)15-12-3-1-2-11(12)14/h4-8,11-12,14H,1-3H2/t11-,12-/m1/s1 |
| InChIKey | SOIRQQLIUDGLNO-VXGBXAGGSA-N |
| XLogP | 1.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|