C11H13BrO2 — CID 102735405
trans-(1R,2R)-2-(3-bromophenoxy)cyclopentan-1-ol (PubChem CID 102735405) has the molecular formula C11H13BrO2 and a molecular weight of 257.13 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3-bromophenoxy)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(3-bromophenoxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102735405 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | trans-(1R,2R)-2-(3-bromophenoxy)cyclopentan-1-ol |
| SMILES | O[C@@H]1CCC[C@H]1Oc1cccc(Br)c1 |
| InChI | InChI=1S/C11H13BrO2/c12-8-3-1-4-9(7-8)14-11-6-2-5-10(11)13/h1,3-4,7,10-11,13H,2,5-6H2/t10-,11-/m1/s1 |
| InChIKey | MLZIKNLLXGKJHF-GHMZBOCLSA-N |
| XLogP | 2.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |