C12H15FO2 — CID 102732532
trans-(1R,2R)-2-(3-fluorophenoxy)cyclohexan-1-ol (PubChem CID 102732532) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3-fluorophenoxy)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(3-fluorophenoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102732532 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | trans-(1R,2R)-2-(3-fluorophenoxy)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1Oc1cccc(F)c1 |
| InChI | InChI=1S/C12H15FO2/c13-9-4-3-5-10(8-9)15-12-7-2-1-6-11(12)14/h3-5,8,11-12,14H,1-2,6-7H2/t11-,12-/m1/s1 |
| InChIKey | VATYMUAUAJJXOC-VXGBXAGGSA-N |
| XLogP | 2.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |