C19H30O2 — CID 63472714
2-(4-tert-butylphenoxy)-4-propan-2-ylcyclohexan-1-ol (PubChem CID 63472714) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-4-propan-2-ylcyclohexan-1-ol.
| Compound Name | 2-(4-tert-butylphenoxy)-4-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 63472714 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-4-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)C1CCC(O)C(Oc2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C19H30O2/c1-13(2)14-6-11-17(20)18(12-14)21-16-9-7-15(8-10-16)19(3,4)5/h7-10,13-14,17-18,20H,6,11-12H2,1-5H3 |
| InChIKey | OTXSKZCMEMHGQH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |